C19H27NO5 — CID 11279519
tert-butyl 4-(4-methoxy-2-methoxycarbonylphenyl)piperidine-1-carboxylate (PubChem CID 11279519) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is tert-butyl 4-(4-methoxy-2-methoxycarbonylphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-methoxy-2-methoxycarbonylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11279519 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | tert-butyl 4-(4-methoxy-2-methoxycarbonylphenyl)piperidine-1-carboxylate |
| SMILES | COC(=O)c1cc(OC)ccc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H27NO5/c1-19(2,3)25-18(22)20-10-8-13(9-11-20)15-7-6-14(23-4)12-16(15)17(21)24-5/h6-7,12-13H,8-11H2,1-5H3 |
| InChIKey | CCDSWGLQOYLLHH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |