C19H26FNO4 — CID 166077537
tert-butyl 4-(2-fluoro-4-methoxycarbonyl-5-methylphenyl)piperidine-1-carboxylate (PubChem CID 166077537) has the molecular formula C19H26FNO4 and a molecular weight of 351.42 g/mol. Its IUPAC name is tert-butyl 4-(2-fluoro-4-methoxycarbonyl-5-methylphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-fluoro-4-methoxycarbonyl-5-methylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166077537 |
| Molecular Formula | C19H26FNO4 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | tert-butyl 4-(2-fluoro-4-methoxycarbonyl-5-methylphenyl)piperidine-1-carboxylate |
| SMILES | COC(=O)c1cc(F)c(C2CCN(C(=O)OC(C)(C)C)CC2)cc1C |
| InChI | InChI=1S/C19H26FNO4/c1-12-10-15(16(20)11-14(12)17(22)24-5)13-6-8-21(9-7-13)18(23)25-19(2,3)4/h10-11,13H,6-9H2,1-5H3 |
| InChIKey | QZPYNLSHEVUHGJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |