C20H29NO6S — CID 66559776
tert-butyl 4-(4-methoxycarbonyl-5-methyl-2-methylsulfonylphenyl)piperidine-1-carboxylate (PubChem CID 66559776) has the molecular formula C20H29NO6S and a molecular weight of 411.52 g/mol. Its IUPAC name is tert-butyl 4-(4-methoxycarbonyl-5-methyl-2-methylsulfonylphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-methoxycarbonyl-5-methyl-2-methylsulfonylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66559776 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | tert-butyl 4-(4-methoxycarbonyl-5-methyl-2-methylsulfonylphenyl)piperidine-1-carboxylate |
| SMILES | COC(=O)c1cc(S(C)(=O)=O)c(C2CCN(C(=O)OC(C)(C)C)CC2)cc1C |
| InChI | InChI=1S/C20H29NO6S/c1-13-11-16(17(28(6,24)25)12-15(13)18(22)26-5)14-7-9-21(10-8-14)19(23)27-20(2,3)4/h11-12,14H,7-10H2,1-6H3 |
| InChIKey | YPMYKPOHFJLYRQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |