C19H27BrN2O4 — CID 70872672
tert-butyl 4-(5-bromo-3-methoxycarbonyl-2-methylanilino)piperidine-1-carboxylate (PubChem CID 70872672) has the molecular formula C19H27BrN2O4 and a molecular weight of 427.34 g/mol. Its IUPAC name is tert-butyl 4-(5-bromo-3-methoxycarbonyl-2-methylanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-bromo-3-methoxycarbonyl-2-methylanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70872672 |
| Molecular Formula | C19H27BrN2O4 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | tert-butyl 4-(5-bromo-3-methoxycarbonyl-2-methylanilino)piperidine-1-carboxylate |
| SMILES | COC(=O)c1cc(Br)cc(NC2CCN(C(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C19H27BrN2O4/c1-12-15(17(23)25-5)10-13(20)11-16(12)21-14-6-8-22(9-7-14)18(24)26-19(2,3)4/h10-11,14,21H,6-9H2,1-5H3 |
| InChIKey | NXAKGSXVXHPETD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |