C22H30BrN3O6 — CID 168569381
dimethyl (E)-2-[5-bromo-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]anilino]but-2-enedioate (PubChem CID 168569381) has the molecular formula C22H30BrN3O6 and a molecular weight of 512.40 g/mol. Its IUPAC name is dimethyl (E)-2-[5-bromo-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[5-bromo-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569381 |
| Molecular Formula | C22H30BrN3O6 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | dimethyl (E)-2-[5-bromo-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(Br)ccc1NC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)OC |
| InChI | InChI=1S/C22H30BrN3O6/c1-22(2,3)32-21(29)26-10-8-15(9-11-26)24-16-7-6-14(23)12-17(16)25-18(20(28)31-5)13-19(27)30-4/h6-7,12-13,15,24-25H,8-11H2,1-5H3/b18-13+ |
| InChIKey | HSTYYBSHYVQCJQ-QGOAFFKASA-N |
| XLogP | 3.90 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|