C18H28BrN7O2 — CID 168603549
tert-butyl 4-[2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-bromoanilino]piperidine-1-carboxylate (PubChem CID 168603549) has the molecular formula C18H28BrN7O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is tert-butyl 4-[2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-bromoanilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-bromoanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168603549 |
| Molecular Formula | C18H28BrN7O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | tert-butyl 4-[2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-bromoanilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccc(Br)cc2/N=C(\N)N=C(N)N)CC1 |
| InChI | InChI=1S/C18H28BrN7O2/c1-18(2,3)28-17(27)26-8-6-12(7-9-26)23-13-5-4-11(19)10-14(13)24-16(22)25-15(20)21/h4-5,10,12,23H,6-9H2,1-3H3,(H6,20,21,22,24,25) |
| InChIKey | PFEOSZZHNIUETP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|