C17H24F3N3O6S2 — CID 67225879
tert-butyl 4-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]piperidine-1-carboxylate (PubChem CID 67225879) has the molecular formula C17H24F3N3O6S2 and a molecular weight of 487.52 g/mol. Its IUPAC name is tert-butyl 4-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67225879 |
| Molecular Formula | C17H24F3N3O6S2 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | tert-butyl 4-[4-sulfamoyl-2-(trifluoromethylsulfonyl)anilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccc(S(N)(=O)=O)cc2S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H24F3N3O6S2/c1-16(2,3)29-15(24)23-8-6-11(7-9-23)22-13-5-4-12(31(21,27)28)10-14(13)30(25,26)17(18,19)20/h4-5,10-11,22H,6-9H2,1-3H3,(H2,21,27,28) |
| InChIKey | WNHAEOLVOOEIKA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |