C14H20N4O6S — CID 67126474
tert-butyl 3-(2-nitro-4-sulfamoylanilino)azetidine-1-carboxylate (PubChem CID 67126474) has the molecular formula C14H20N4O6S and a molecular weight of 372.40 g/mol. Its IUPAC name is tert-butyl 3-(2-nitro-4-sulfamoylanilino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-nitro-4-sulfamoylanilino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 67126474 |
| Molecular Formula | C14H20N4O6S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | tert-butyl 3-(2-nitro-4-sulfamoylanilino)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H20N4O6S/c1-14(2,3)24-13(19)17-7-9(8-17)16-11-5-4-10(25(15,22)23)6-12(11)18(20)21/h4-6,9,16H,7-8H2,1-3H3,(H2,15,22,23) |
| InChIKey | HRWLXKONGGMFHM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|