C19H27N3O6S — CID 58998512
tert-butyl 3-(4-methylsulfonyl-2-nitroanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 58998512) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is tert-butyl 3-(4-methylsulfonyl-2-nitroanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-(4-methylsulfonyl-2-nitroanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 58998512 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | tert-butyl 3-(4-methylsulfonyl-2-nitroanilino)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(Nc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C19H27N3O6S/c1-19(2,3)28-18(23)21-13-5-6-14(21)10-12(9-13)20-16-8-7-15(29(4,26)27)11-17(16)22(24)25/h7-8,11-14,20H,5-6,9-10H2,1-4H3 |
| InChIKey | XRIGQWUGCLJNOG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|