C20H28N2O7S — CID 57462383
tert-butyl (2S)-2-cyclohexyl-2-[(4-methylsulfonyl-2-nitrobenzoyl)amino]acetate (PubChem CID 57462383) has the molecular formula C20H28N2O7S and a molecular weight of 440.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-cyclohexyl-2-[(4-methylsulfonyl-2-nitrobenzoyl)amino]acetate.
| Compound Name | tert-butyl (2S)-2-cyclohexyl-2-[(4-methylsulfonyl-2-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 57462383 |
| Molecular Formula | C20H28N2O7S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | tert-butyl (2S)-2-cyclohexyl-2-[(4-methylsulfonyl-2-nitrobenzoyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)[C@@H](NC(=O)c1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C20H28N2O7S/c1-20(2,3)29-19(24)17(13-8-6-5-7-9-13)21-18(23)15-11-10-14(30(4,27)28)12-16(15)22(25)26/h10-13,17H,5-9H2,1-4H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | HNOWHKQGPSIGRQ-KRWDZBQOSA-N |
| XLogP | 3.02 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|