C21H22N2O5 — CID 69350044
(2S)-2-cyclohexyl-2-[(2-nitro-4-phenylbenzoyl)amino]acetic acid (PubChem CID 69350044) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[(2-nitro-4-phenylbenzoyl)amino]acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-[(2-nitro-4-phenylbenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 69350044 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[(2-nitro-4-phenylbenzoyl)amino]acetic acid |
| SMILES | O=C(N[C@H](C(=O)O)C1CCCCC1)c1ccc(-c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N2O5/c24-20(22-19(21(25)26)15-9-5-2-6-10-15)17-12-11-16(13-18(17)23(27)28)14-7-3-1-4-8-14/h1,3-4,7-8,11-13,15,19H,2,5-6,9-10H2,(H,22,24)(H,25,26)/t19-/m0/s1 |
| InChIKey | XMBRYIRWEJQPEO-IBGZPJMESA-N |
| XLogP | 4.03 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|