C27H26N2O5 — CID 118054120
[[1-cyclohexyl-2-[4-(4-nitrophenyl)phenyl]-2-oxoethyl]amino] benzoate (PubChem CID 118054120) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is [[1-cyclohexyl-2-[4-(4-nitrophenyl)phenyl]-2-oxoethyl]amino] benzoate.
| Compound Name | [[1-cyclohexyl-2-[4-(4-nitrophenyl)phenyl]-2-oxoethyl]amino] benzoate |
|---|---|
| PubChem CID | 118054120 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [[1-cyclohexyl-2-[4-(4-nitrophenyl)phenyl]-2-oxoethyl]amino] benzoate |
| SMILES | O=C(ONC(C(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O5/c30-26(22-13-11-19(12-14-22)20-15-17-24(18-16-20)29(32)33)25(21-7-3-1-4-8-21)28-34-27(31)23-9-5-2-6-10-23/h2,5-6,9-18,21,25,28H,1,3-4,7-8H2 |
| InChIKey | BLVWYWHMHDFDKP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|