About [(1S)-1-cyclopentylethyl] 4-nitrobenzoate
[(1S)-1-cyclopentylethyl] 4-nitrobenzoate (PubChem CID 163238968) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is [(1S)-1-cyclopentylethyl] 4-nitrobenzoate.
Molecular Properties
| Compound Name | [(1S)-1-cyclopentylethyl] 4-nitrobenzoate |
| PubChem CID | 163238968 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [(1S)-1-cyclopentylethyl] 4-nitrobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1)C1CCCC1 |
| InChI | InChI=1S/C14H17NO4/c1-10(11-4-2-3-5-11)19-14(16)12-6-8-13(9-7-12)15(17)18/h6-11H,2-5H2,1H3/t10-/m0/s1 |
| InChIKey | QREYQKDJPGPSTM-JTQLQIEISA-N |
| XLogP | 3.33 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-cyclopentylethyl] 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-cyclopentylethyl] 4-nitrobenzoate?
The IUPAC name of [(1S)-1-cyclopentylethyl] 4-nitrobenzoate (CID 163238968) is [(1S)-1-cyclopentylethyl] 4-nitrobenzoate.
What is the SMILES notation for [(1S)-1-cyclopentylethyl] 4-nitrobenzoate?
The canonical SMILES for [(1S)-1-cyclopentylethyl] 4-nitrobenzoate is C[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1)C1CCCC1.
What is the InChIKey of [(1S)-1-cyclopentylethyl] 4-nitrobenzoate?
The InChIKey is QREYQKDJPGPSTM-JTQLQIEISA-N. The full InChI is InChI=1S/C14H17NO4/c1-10(11-4-2-3-5-11)19-14(16)12-6-8-13(9-7-12)15(17)18/h6-11H,2-5H2,1H3/t10-/m0/s1.
What are the key properties of [(1S)-1-cyclopentylethyl] 4-nitrobenzoate?
[(1S)-1-cyclopentylethyl] 4-nitrobenzoate has a molecular weight of 263.29 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-cyclopentylethyl] 4-nitrobenzoate is sourced from PubChem (CID 163238968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).