C19H24N2O7 — CID 102268769
[(1S)-1-[(2S,3S)-3-[(1R)-1-(oxan-2-yloxy)ethyl]-4-oxoazetidin-2-yl]ethyl] 4-nitrobenzoate (PubChem CID 102268769) has the molecular formula C19H24N2O7 and a molecular weight of 392.41 g/mol. Its IUPAC name is [(1S)-1-[(2S,3S)-3-[(1R)-1-(oxan-2-yloxy)ethyl]-4-oxoazetidin-2-yl]ethyl] 4-nitrobenzoate.
| Compound Name | [(1S)-1-[(2S,3S)-3-[(1R)-1-(oxan-2-yloxy)ethyl]-4-oxoazetidin-2-yl]ethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 102268769 |
| Molecular Formula | C19H24N2O7 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [(1S)-1-[(2S,3S)-3-[(1R)-1-(oxan-2-yloxy)ethyl]-4-oxoazetidin-2-yl]ethyl] 4-nitrobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1)[C@H]1NC(=O)[C@@H]1[C@@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C19H24N2O7/c1-11(27-15-5-3-4-10-26-15)16-17(20-18(16)22)12(2)28-19(23)13-6-8-14(9-7-13)21(24)25/h6-9,11-12,15-17H,3-5,10H2,1-2H3,(H,20,22)/t11-,12+,15?,16-,17-/m1/s1 |
| InChIKey | VNFLRZSKJJDQND-CGVLNTEHSA-N |
| XLogP | 2.19 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|