C17H22N2O5 — CID 7834887
[(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4-nitrobenzoate (PubChem CID 7834887) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is [(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4-nitrobenzoate.
| Compound Name | [(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7834887 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | [(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4-nitrobenzoate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)[C@@H](C)OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H22N2O5/c1-11-5-3-4-6-15(11)18-16(20)12(2)24-17(21)13-7-9-14(10-8-13)19(22)23/h7-12,15H,3-6H2,1-2H3,(H,18,20)/t11-,12-,15+/m1/s1 |
| InChIKey | GOLDOUMCZQSVSR-JMSVASOKSA-N |
| XLogP | 2.84 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|