C21H24N2O6 — CID 7691580
[(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 5-(4-nitrophenyl)furan-2-carboxylate (PubChem CID 7691580) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is [(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 5-(4-nitrophenyl)furan-2-carboxylate.
| Compound Name | [(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 5-(4-nitrophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 7691580 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 5-(4-nitrophenyl)furan-2-carboxylate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)[C@@H](C)OC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C21H24N2O6/c1-13-5-3-4-6-17(13)22-20(24)14(2)28-21(25)19-12-11-18(29-19)15-7-9-16(10-8-15)23(26)27/h7-14,17H,3-6H2,1-2H3,(H,22,24)/t13-,14-,17+/m1/s1 |
| InChIKey | OZKXJCZLPXDWSN-CPUCHLNUSA-N |
| XLogP | 4.09 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|