C19H26N2O7 — CID 7583122
[(2R)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 7583122) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is [(2R)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [(2R)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 7583122 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [(2R)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)O[C@H](C)C(=O)N[C@H]2CCCC[C@@H]2C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H26N2O7/c1-11-7-5-6-8-14(11)20-18(22)12(2)28-19(23)13-9-16(26-3)17(27-4)10-15(13)21(24)25/h9-12,14H,5-8H2,1-4H3,(H,20,22)/t11-,12+,14-/m0/s1 |
| InChIKey | FEHMWJLVTBFGNU-SCRDCRAPSA-N |
| XLogP | 2.85 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|