C23H27NO5 — CID 18091724
[1-(cycloheptylamino)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate (PubChem CID 18091724) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [1-(cycloheptylamino)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate.
| Compound Name | [1-(cycloheptylamino)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 18091724 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [1-(cycloheptylamino)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)OC(C)C(=O)NC3CCCCCC3)o2)cc1 |
| InChI | InChI=1S/C23H27NO5/c1-15(25)17-9-11-18(12-10-17)20-13-14-21(29-20)23(27)28-16(2)22(26)24-19-7-5-3-4-6-8-19/h9-14,16,19H,3-8H2,1-2H3,(H,24,26) |
| InChIKey | ZJLLQCBSRZDCJP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |