C22H24N2O6 — CID 43015008
[1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate (PubChem CID 43015008) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate.
| Compound Name | [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 43015008 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)OC(C)C(=O)NC(=O)NC3CCCC3)o2)cc1 |
| InChI | InChI=1S/C22H24N2O6/c1-13(25)15-7-9-16(10-8-15)18-11-12-19(30-18)21(27)29-14(2)20(26)24-22(28)23-17-5-3-4-6-17/h7-12,14,17H,3-6H2,1-2H3,(H2,23,24,26,28) |
| InChIKey | PAOVIXXXFQFLJI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |