C23H20O6 — CID 7727975
[(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate (PubChem CID 7727975) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate.
| Compound Name | [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 7727975 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-(4-acetylphenyl)furan-2-carboxylate |
| SMILES | COc1ccc(C(=O)[C@@H](C)OC(=O)c2ccc(-c3ccc(C(C)=O)cc3)o2)cc1 |
| InChI | InChI=1S/C23H20O6/c1-14(24)16-4-6-17(7-5-16)20-12-13-21(29-20)23(26)28-15(2)22(25)18-8-10-19(27-3)11-9-18/h4-13,15H,1-3H3/t15-/m1/s1 |
| InChIKey | YZYPXKVXOCZOER-OAHLLOKOSA-N |
| XLogP | 4.59 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |