C28H23NO6 — CID 16572310
[2-(4-methoxyanilino)-2-oxo-1-phenylethyl] 5-(4-acetylphenyl)furan-2-carboxylate (PubChem CID 16572310) has the molecular formula C28H23NO6 and a molecular weight of 469.49 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxo-1-phenylethyl] 5-(4-acetylphenyl)furan-2-carboxylate.
| Compound Name | [2-(4-methoxyanilino)-2-oxo-1-phenylethyl] 5-(4-acetylphenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 16572310 |
| Molecular Formula | C28H23NO6 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxo-1-phenylethyl] 5-(4-acetylphenyl)furan-2-carboxylate |
| SMILES | COc1ccc(NC(=O)C(OC(=O)c2ccc(-c3ccc(C(C)=O)cc3)o2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23NO6/c1-18(30)19-8-10-20(11-9-19)24-16-17-25(34-24)28(32)35-26(21-6-4-3-5-7-21)27(31)29-22-12-14-23(33-2)15-13-22/h3-17,26H,1-2H3,(H,29,31) |
| InChIKey | FXDJGWJSYKHPRN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |