C30H30N2O8 — CID 98541790
[(6R,7R)-7-(4-nitrobenzoyl)oxy-6-bicyclo[10.2.2]hexadeca-1(14),12,15-trienyl] 4-nitrobenzoate (PubChem CID 98541790) has the molecular formula C30H30N2O8 and a molecular weight of 546.58 g/mol. Its IUPAC name is [(6R,7R)-7-(4-nitrobenzoyl)oxy-6-bicyclo[10.2.2]hexadeca-1(14),12,15-trienyl] 4-nitrobenzoate.
| Compound Name | [(6R,7R)-7-(4-nitrobenzoyl)oxy-6-bicyclo[10.2.2]hexadeca-1(14),12,15-trienyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 98541790 |
| Molecular Formula | C30H30N2O8 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | [(6R,7R)-7-(4-nitrobenzoyl)oxy-6-bicyclo[10.2.2]hexadeca-1(14),12,15-trienyl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1CCCCc2ccc(cc2)CCCC[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H30N2O8/c33-29(23-13-17-25(18-14-23)31(35)36)39-27-7-3-1-5-21-9-11-22(12-10-21)6-2-4-8-28(27)40-30(34)24-15-19-26(20-16-24)32(37)38/h9-20,27-28H,1-8H2/t27-,28-/m1/s1 |
| InChIKey | GYFHFERMBSDBFP-VSGBNLITSA-N |
| XLogP | 6.39 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|