C14H19NO5Si — CID 10881426
[(3S,4R)-4-hydroxy-1,1-dimethylsilinan-3-yl] 4-nitrobenzoate (PubChem CID 10881426) has the molecular formula C14H19NO5Si and a molecular weight of 309.39 g/mol. Its IUPAC name is [(3S,4R)-4-hydroxy-1,1-dimethylsilinan-3-yl] 4-nitrobenzoate.
| Compound Name | [(3S,4R)-4-hydroxy-1,1-dimethylsilinan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 10881426 |
| Molecular Formula | C14H19NO5Si |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [(3S,4R)-4-hydroxy-1,1-dimethylsilinan-3-yl] 4-nitrobenzoate |
| SMILES | C[Si]1(C)CC[C@@H](O)[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C14H19NO5Si/c1-21(2)8-7-12(16)13(9-21)20-14(17)10-3-5-11(6-4-10)15(18)19/h3-6,12-13,16H,7-9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | YLYVMJJRDUEHJI-CHWSQXEVSA-N |
| XLogP | 2.59 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|