C13H13NO6 — CID 67320682
[(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] 4-nitrobenzoate (PubChem CID 67320682) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is [(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] 4-nitrobenzoate.
| Compound Name | [(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 67320682 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | [(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] 4-nitrobenzoate |
| SMILES | O=C(O[C@H]1COC2OCCC21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13NO6/c15-12(8-1-3-9(4-2-8)14(16)17)20-11-7-19-13-10(11)5-6-18-13/h1-4,10-11,13H,5-7H2/t10?,11-,13?/m0/s1 |
| InChIKey | OBDJXHDUMPQSCX-AKJDGMEZSA-N |
| XLogP | 1.51 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|