C26H19N3O13 — CID 54123853
[(2R,3R,4S)-3,4-bis[(4-nitrobenzoyl)oxy]oxolan-2-yl]methyl 4-nitrobenzoate (PubChem CID 54123853) has the molecular formula C26H19N3O13 and a molecular weight of 581.45 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-bis[(4-nitrobenzoyl)oxy]oxolan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(2R,3R,4S)-3,4-bis[(4-nitrobenzoyl)oxy]oxolan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 54123853 |
| Molecular Formula | C26H19N3O13 |
| Molecular Weight | 581.45 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | [(2R,3R,4S)-3,4-bis[(4-nitrobenzoyl)oxy]oxolan-2-yl]methyl 4-nitrobenzoate |
| SMILES | O=C(OC[C@H]1OC[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@@H]1OC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H19N3O13/c30-24(15-1-7-18(8-2-15)27(33)34)40-13-21-23(42-26(32)17-5-11-20(12-6-17)29(37)38)22(14-39-21)41-25(31)16-3-9-19(10-4-16)28(35)36/h1-12,21-23H,13-14H2/t21-,22+,23-/m1/s1 |
| InChIKey | QXXMXYYZFKNGIG-XPWALMASSA-N |
| XLogP | 3.42 |
| TPSA | 217.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|