C13H15NO5 — CID 132582425
[(2S,3S)-3-propyloxiran-2-yl]methyl 4-nitrobenzoate (PubChem CID 132582425) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is [(2S,3S)-3-propyloxiran-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(2S,3S)-3-propyloxiran-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 132582425 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [(2S,3S)-3-propyloxiran-2-yl]methyl 4-nitrobenzoate |
| SMILES | CCC[C@@H]1O[C@H]1COC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15NO5/c1-2-3-11-12(19-11)8-18-13(15)9-4-6-10(7-5-9)14(16)17/h4-7,11-12H,2-3,8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | GYDWOWQXLMRKCG-RYUDHWBXSA-N |
| XLogP | 2.32 |
| TPSA | 81.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|