C15H17NO8 — CID 163240154
[(5S)-5-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]methyl 4-nitrobenzoate (PubChem CID 163240154) has the molecular formula C15H17NO8 and a molecular weight of 339.30 g/mol. Its IUPAC name is [(5S)-5-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(5S)-5-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 163240154 |
| Molecular Formula | C15H17NO8 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [(5S)-5-(2-methoxy-2-oxoethyl)-1,4-dioxan-2-yl]methyl 4-nitrobenzoate |
| SMILES | COC(=O)C[C@H]1COC(COC(=O)c2ccc([N+](=O)[O-])cc2)CO1 |
| InChI | InChI=1S/C15H17NO8/c1-21-14(17)6-12-7-23-13(8-22-12)9-24-15(18)10-2-4-11(5-3-10)16(19)20/h2-5,12-13H,6-9H2,1H3/t12-,13?/m0/s1 |
| InChIKey | RUEICTCYPMHHQZ-UEWDXFNNSA-N |
| XLogP | 1.10 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|