C18H16N2O6 — CID 2815773
[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-nitrobenzoate (PubChem CID 2815773) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-nitrobenzoate.
| Compound Name | [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 2815773 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-nitrobenzoate |
| SMILES | COc1ccccc1C1=NOC(COC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H16N2O6/c1-24-17-5-3-2-4-15(17)16-10-14(26-19-16)11-25-18(21)12-6-8-13(9-7-12)20(22)23/h2-9,14H,10-11H2,1H3 |
| InChIKey | WAHWAVDUMOEKLY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|