C24H27N3O5 — CID 42790386
ethyl 4-[[[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylcarbamoyl]amino]benzoate (PubChem CID 42790386) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is ethyl 4-[[[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylcarbamoyl]amino]benzoate.
| Compound Name | ethyl 4-[[[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylcarbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 42790386 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | ethyl 4-[[[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylcarbamoyl]amino]benzoate |
| SMILES | C=CCN(CC1CC(c2ccccc2OC)=NO1)C(=O)Nc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C24H27N3O5/c1-4-14-27(24(29)25-18-12-10-17(11-13-18)23(28)31-5-2)16-19-15-21(26-32-19)20-8-6-7-9-22(20)30-3/h4,6-13,19H,1,5,14-16H2,2-3H3,(H,25,29) |
| InChIKey | XULFPNZJFGRPSV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|