C24H28N2O3 — CID 42790003
N-[[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-phenyl-N-prop-2-enylbutanamide (PubChem CID 42790003) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-phenyl-N-prop-2-enylbutanamide.
| Compound Name | N-[[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-phenyl-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 42790003 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-[[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2-phenyl-N-prop-2-enylbutanamide |
| SMILES | C=CCN(CC1CC(c2ccccc2OC)=NO1)C(=O)C(CC)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O3/c1-4-15-26(24(27)20(5-2)18-11-7-6-8-12-18)17-19-16-22(25-29-19)21-13-9-10-14-23(21)28-3/h4,6-14,19-20H,1,5,15-17H2,2-3H3 |
| InChIKey | ZJRRQBWFIHJLMZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|