C16H20ClN3O2 — CID 42816084
1-[[3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-ethyl-1-prop-2-enylurea (PubChem CID 42816084) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-ethyl-1-prop-2-enylurea.
| Compound Name | 1-[[3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-ethyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 42816084 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-ethyl-1-prop-2-enylurea |
| SMILES | C=CCN(CC1CC(c2ccccc2Cl)=NO1)C(=O)NCC |
| InChI | InChI=1S/C16H20ClN3O2/c1-3-9-20(16(21)18-4-2)11-12-10-15(19-22-12)13-7-5-6-8-14(13)17/h3,5-8,12H,1,4,9-11H2,2H3,(H,18,21) |
| InChIKey | YMTXEUKZMFDHRW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|