C23H25N3O4 — CID 7418919
ethyl 4-[[[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylcarbamoyl]amino]benzoate (PubChem CID 7418919) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl 4-[[[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylcarbamoyl]amino]benzoate.
| Compound Name | ethyl 4-[[[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylcarbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 7418919 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | ethyl 4-[[[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylcarbamoyl]amino]benzoate |
| SMILES | C=CCN(C[C@H]1CC(c2ccccc2)=NO1)C(=O)Nc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-3-14-26(16-20-15-21(25-30-20)17-8-6-5-7-9-17)23(28)24-19-12-10-18(11-13-19)22(27)29-4-2/h3,5-13,20H,1,4,14-16H2,2H3,(H,24,28)/t20-/m1/s1 |
| InChIKey | VUMDGCQNQGNIQS-HXUWFJFHSA-N |
| XLogP | 4.08 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|