C19H15FN2O10 — CID 118688640
[(3R,4S)-4-fluoro-5-hydroxy-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate (PubChem CID 118688640) has the molecular formula C19H15FN2O10 and a molecular weight of 450.33 g/mol. Its IUPAC name is [(3R,4S)-4-fluoro-5-hydroxy-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(3R,4S)-4-fluoro-5-hydroxy-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 118688640 |
| Molecular Formula | C19H15FN2O10 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | [(3R,4S)-4-fluoro-5-hydroxy-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate |
| SMILES | O=C(OCC1OC(O)[C@@H](F)[C@@H]1OC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15FN2O10/c20-15-16(32-18(24)11-3-7-13(8-4-11)22(28)29)14(31-19(15)25)9-30-17(23)10-1-5-12(6-2-10)21(26)27/h1-8,14-16,19,25H,9H2/t14?,15-,16+,19?/m0/s1 |
| InChIKey | LTQSJZBPLABQNO-YJTLQXIOSA-N |
| XLogP | 1.94 |
| TPSA | 168.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|