C26H19Cl3O8 — CID 165347928
[(2R,3R,4R,5S)-3,4-bis[(4-chlorobenzoyl)oxy]-5-hydroxyoxolan-2-yl]methyl 4-chlorobenzoate (PubChem CID 165347928) has the molecular formula C26H19Cl3O8 and a molecular weight of 565.79 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-bis[(4-chlorobenzoyl)oxy]-5-hydroxyoxolan-2-yl]methyl 4-chlorobenzoate.
| Compound Name | [(2R,3R,4R,5S)-3,4-bis[(4-chlorobenzoyl)oxy]-5-hydroxyoxolan-2-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 165347928 |
| Molecular Formula | C26H19Cl3O8 |
| Molecular Weight | 565.79 g/mol |
| Exact Mass | 564.01 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-bis[(4-chlorobenzoyl)oxy]-5-hydroxyoxolan-2-yl]methyl 4-chlorobenzoate |
| SMILES | O=C(OC[C@H]1O[C@H](O)[C@H](OC(=O)c2ccc(Cl)cc2)[C@@H]1OC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H19Cl3O8/c27-17-7-1-14(2-8-17)23(30)34-13-20-21(36-24(31)15-3-9-18(28)10-4-15)22(26(33)35-20)37-25(32)16-5-11-19(29)12-6-16/h1-12,20-22,26,33H,13H2/t20-,21-,22-,26+/m1/s1 |
| InChIKey | DOQACGDURGTKPI-BILGYAHESA-N |
| XLogP | 4.97 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|