C19H16Cl2FNO6 — CID 155417465
[(3R,4S)-3-(4-chlorobenzoyl)oxy-4-fluoro-5-(hydroxyamino)oxolan-2-yl]methyl 4-chlorobenzoate (PubChem CID 155417465) has the molecular formula C19H16Cl2FNO6 and a molecular weight of 444.24 g/mol. Its IUPAC name is [(3R,4S)-3-(4-chlorobenzoyl)oxy-4-fluoro-5-(hydroxyamino)oxolan-2-yl]methyl 4-chlorobenzoate.
| Compound Name | [(3R,4S)-3-(4-chlorobenzoyl)oxy-4-fluoro-5-(hydroxyamino)oxolan-2-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 155417465 |
| Molecular Formula | C19H16Cl2FNO6 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | [(3R,4S)-3-(4-chlorobenzoyl)oxy-4-fluoro-5-(hydroxyamino)oxolan-2-yl]methyl 4-chlorobenzoate |
| SMILES | O=C(OCC1OC(NO)[C@@H](F)[C@@H]1OC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2FNO6/c20-12-5-1-10(2-6-12)18(24)27-9-14-16(15(22)17(23-26)28-14)29-19(25)11-3-7-13(21)8-4-11/h1-8,14-17,23,26H,9H2/t14?,15-,16+,17?/m0/s1 |
| InChIKey | REMQKXCMOJCMQM-VUROTCPHSA-N |
| XLogP | 3.42 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|