C19H15Cl3O5 — CID 11407758
[(2S,3R,5S)-5-chloro-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate (PubChem CID 11407758) has the molecular formula C19H15Cl3O5 and a molecular weight of 429.68 g/mol. Its IUPAC name is [(2S,3R,5S)-5-chloro-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate.
| Compound Name | [(2S,3R,5S)-5-chloro-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 11407758 |
| Molecular Formula | C19H15Cl3O5 |
| Molecular Weight | 429.68 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | [(2S,3R,5S)-5-chloro-3-(4-chlorobenzoyl)oxyoxolan-2-yl]methyl 4-chlorobenzoate |
| SMILES | O=C(OC[C@@H]1O[C@@H](Cl)C[C@H]1OC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15Cl3O5/c20-13-5-1-11(2-6-13)18(23)25-10-16-15(9-17(22)26-16)27-19(24)12-3-7-14(21)8-4-12/h1-8,15-17H,9-10H2/t15-,16+,17-/m1/s1 |
| InChIKey | QEHCZULNFYDPPL-IXDOHACOSA-N |
| XLogP | 4.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|