C25H21Cl2NO5Y — CID 58618530
[3-(4-chlorobenzoyl)oxy-5-(5-methyl-3H-pyridin-1-ium-3-id-1-yl)oxolan-2-yl]methyl 4-chlorobenzoate;yttrium (PubChem CID 58618530) has the molecular formula C25H21Cl2NO5Y and a molecular weight of 575.26 g/mol. Its IUPAC name is [3-(4-chlorobenzoyl)oxy-5-(5-methyl-3H-pyridin-1-ium-3-id-1-yl)oxolan-2-yl]methyl 4-chlorobenzoate;yttrium.
| Compound Name | [3-(4-chlorobenzoyl)oxy-5-(5-methyl-3H-pyridin-1-ium-3-id-1-yl)oxolan-2-yl]methyl 4-chlorobenzoate;yttrium |
|---|---|
| PubChem CID | 58618530 |
| Molecular Formula | C25H21Cl2NO5Y |
| Molecular Weight | 575.26 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | [3-(4-chlorobenzoyl)oxy-5-(5-methyl-3H-pyridin-1-ium-3-id-1-yl)oxolan-2-yl]methyl 4-chlorobenzoate;yttrium |
| SMILES | Cc1c[c-]c[n+](C2CC(OC(=O)c3ccc(Cl)cc3)C(COC(=O)c3ccc(Cl)cc3)O2)c1.[Y] |
| InChI | InChI=1S/C25H21Cl2NO5.Y/c1-16-3-2-12-28(14-16)23-13-21(33-25(30)18-6-10-20(27)11-7-18)22(32-23)15-31-24(29)17-4-8-19(26)9-5-17;/h3-12,14,21-23H,13,15H2,1H3; |
| InChIKey | RVEBXKNBAVBLFM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|