C22H23NO5S — CID 13009532
[(2R,3S,5R)-5-carbamothioyl-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 13009532) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is [(2R,3S,5R)-5-carbamothioyl-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,5R)-5-carbamothioyl-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 13009532 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [(2R,3S,5R)-5-carbamothioyl-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@@H](C(N)=S)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H23NO5S/c1-13-3-7-15(8-4-13)21(24)26-12-19-17(11-18(27-19)20(23)29)28-22(25)16-9-5-14(2)6-10-16/h3-10,17-19H,11-12H2,1-2H3,(H2,23,29)/t17-,18+,19+/m0/s1 |
| InChIKey | CKSNUBAJYFOBTH-IPMKNSEASA-N |
| XLogP | 3.13 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|