C29H29N3O5 — CID 10553422
[(2R,3S,5R)-5-[4-(2-azidoethyl)phenyl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 10553422) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[4-(2-azidoethyl)phenyl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,5R)-5-[4-(2-azidoethyl)phenyl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 10553422 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | [(2R,3S,5R)-5-[4-(2-azidoethyl)phenyl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@@H](c3ccc(CCN=[N+]=[N-])cc3)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H29N3O5/c1-19-3-9-23(10-4-19)28(33)35-18-27-26(37-29(34)24-11-5-20(2)6-12-24)17-25(36-27)22-13-7-21(8-14-22)15-16-31-32-30/h3-14,25-27H,15-18H2,1-2H3/t25-,26+,27-/m1/s1 |
| InChIKey | BFKNMBOVUNRTTL-KWXIBIRDSA-N |
| XLogP | 6.07 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|