C21H22O5 — CID 147386319
[(3S)-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 147386319) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(3S)-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(3S)-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 147386319 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(3S)-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC2OCC[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H22O5/c1-14-3-7-16(8-4-14)20(22)25-13-19-18(11-12-24-19)26-21(23)17-9-5-15(2)6-10-17/h3-10,18-19H,11-13H2,1-2H3/t18-,19?/m0/s1 |
| InChIKey | DLYXWNOJDFHJGV-OYKVQYDMSA-N |
| XLogP | 3.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |