C38H35BrO9 — CID 134878301
[(2R,3R,4S,5R,6S)-6-bromo-3,4,5-tris[(4-methylbenzoyl)oxy]oxan-2-yl]methyl 4-methylbenzoate (PubChem CID 134878301) has the molecular formula C38H35BrO9 and a molecular weight of 715.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-bromo-3,4,5-tris[(4-methylbenzoyl)oxy]oxan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-bromo-3,4,5-tris[(4-methylbenzoyl)oxy]oxan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 134878301 |
| Molecular Formula | C38H35BrO9 |
| Molecular Weight | 715.59 g/mol |
| Exact Mass | 714.15 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-bromo-3,4,5-tris[(4-methylbenzoyl)oxy]oxan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@@H](Br)[C@H](OC(=O)c3ccc(C)cc3)[C@@H](OC(=O)c3ccc(C)cc3)[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C38H35BrO9/c1-22-5-13-26(14-6-22)35(40)44-21-30-31(46-36(41)27-15-7-23(2)8-16-27)32(47-37(42)28-17-9-24(3)10-18-28)33(34(39)45-30)48-38(43)29-19-11-25(4)12-20-29/h5-20,30-34H,21H2,1-4H3/t30-,31-,32+,33-,34-/m1/s1 |
| InChIKey | GNMWIYWKYLSBTA-BGSSSCFASA-N |
| XLogP | 6.87 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|