C21H23BrO9 — CID 102247867
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl 4-ethenylbenzoate (PubChem CID 102247867) has the molecular formula C21H23BrO9 and a molecular weight of 499.31 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl 4-ethenylbenzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl 4-ethenylbenzoate |
|---|---|
| PubChem CID | 102247867 |
| Molecular Formula | C21H23BrO9 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OC[C@H]2O[C@H](Br)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C21H23BrO9/c1-5-14-6-8-15(9-7-14)21(26)27-10-16-17(28-11(2)23)18(29-12(3)24)19(20(22)31-16)30-13(4)25/h5-9,16-20H,1,10H2,2-4H3/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | AFJKVRVWBPNJDZ-OBKDMQGPSA-N |
| XLogP | 2.40 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|