C34H23BrF4O9 — CID 10509155
[(2R,3R,4S,5R,6R)-6-bromo-3,4,5-tris[(4-fluorobenzoyl)oxy]oxan-2-yl]methyl 4-fluorobenzoate (PubChem CID 10509155) has the molecular formula C34H23BrF4O9 and a molecular weight of 731.45 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-bromo-3,4,5-tris[(4-fluorobenzoyl)oxy]oxan-2-yl]methyl 4-fluorobenzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-bromo-3,4,5-tris[(4-fluorobenzoyl)oxy]oxan-2-yl]methyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 10509155 |
| Molecular Formula | C34H23BrF4O9 |
| Molecular Weight | 731.45 g/mol |
| Exact Mass | 730.05 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-bromo-3,4,5-tris[(4-fluorobenzoyl)oxy]oxan-2-yl]methyl 4-fluorobenzoate |
| SMILES | O=C(OC[C@H]1O[C@H](Br)[C@H](OC(=O)c2ccc(F)cc2)[C@@H](OC(=O)c2ccc(F)cc2)[C@@H]1OC(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C34H23BrF4O9/c35-30-29(48-34(43)21-7-15-25(39)16-8-21)28(47-33(42)20-5-13-24(38)14-6-20)27(46-32(41)19-3-11-23(37)12-4-19)26(45-30)17-44-31(40)18-1-9-22(36)10-2-18/h1-16,26-30H,17H2/t26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | AMNYGGXCDWHISY-RLXMVLCYSA-N |
| XLogP | 6.20 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|