C34H29NO9 — CID 71164685
[(3S,4S,6R)-6-amino-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate (PubChem CID 71164685) has the molecular formula C34H29NO9 and a molecular weight of 595.60 g/mol. Its IUPAC name is [(3S,4S,6R)-6-amino-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3S,4S,6R)-6-amino-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71164685 |
| Molecular Formula | C34H29NO9 |
| Molecular Weight | 595.60 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | [(3S,4S,6R)-6-amino-3,4,5-tribenzoyloxyoxan-2-yl]methyl benzoate |
| SMILES | N[C@@H]1OC(COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H29NO9/c35-30-29(44-34(39)25-19-11-4-12-20-25)28(43-33(38)24-17-9-3-10-18-24)27(42-32(37)23-15-7-2-8-16-23)26(41-30)21-40-31(36)22-13-5-1-6-14-22/h1-20,26-30H,21,35H2/t26?,27-,28-,29?,30+/m0/s1 |
| InChIKey | YYMRIRHNWASDCW-QJIGHACUSA-N |
| XLogP | 4.20 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|