C26H23NO7 — CID 135073207
[(2R,5R)-5-amino-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 135073207) has the molecular formula C26H23NO7 and a molecular weight of 461.47 g/mol. Its IUPAC name is [(2R,5R)-5-amino-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,5R)-5-amino-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 135073207 |
| Molecular Formula | C26H23NO7 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [(2R,5R)-5-amino-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | N[C@@H]1O[C@H](COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H23NO7/c27-23-22(34-26(30)19-14-8-3-9-15-19)21(33-25(29)18-12-6-2-7-13-18)20(32-23)16-31-24(28)17-10-4-1-5-11-17/h1-15,20-23H,16,27H2/t20-,21?,22?,23-/m1/s1 |
| InChIKey | OWJLUTZVVAESAR-WYZYGFAWSA-N |
| XLogP | 2.98 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|