C14H18BrClO9 — CID 87432565
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl 2-chloroacetate (PubChem CID 87432565) has the molecular formula C14H18BrClO9 and a molecular weight of 445.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl 2-chloroacetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl 2-chloroacetate |
|---|---|
| PubChem CID | 87432565 |
| Molecular Formula | C14H18BrClO9 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxan-2-yl]methyl 2-chloroacetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Br)O[C@H](COC(=O)CCl)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H18BrClO9/c1-6(17)22-11-9(5-21-10(20)4-16)25-14(15)13(24-8(3)19)12(11)23-7(2)18/h9,11-14H,4-5H2,1-3H3/t9-,11-,12+,13-,14-/m1/s1 |
| InChIKey | AFBSNHSAJCUHMQ-RGCYKPLRSA-N |
| XLogP | 0.68 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|