C12H16BrIO7 — CID 540675
[4,5-diacetyloxy-6-bromo-2-(iodomethyl)oxan-3-yl] acetate (PubChem CID 540675) has the molecular formula C12H16BrIO7 and a molecular weight of 479.06 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-bromo-2-(iodomethyl)oxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-bromo-2-(iodomethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 540675 |
| Molecular Formula | C12H16BrIO7 |
| Molecular Weight | 479.06 g/mol |
| Exact Mass | 477.91 |
| IUPAC Name | [4,5-diacetyloxy-6-bromo-2-(iodomethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(Br)OC(CI)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C12H16BrIO7/c1-5(15)18-9-8(4-14)21-12(13)11(20-7(3)17)10(9)19-6(2)16/h8-12H,4H2,1-3H3 |
| InChIKey | BWIUQMQZKOKROE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.06 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|