C12H17BrO7 — CID 11002676
[(2S,3S,4R,5R)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate (PubChem CID 11002676) has the molecular formula C12H17BrO7 and a molecular weight of 353.17 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 11002676 |
| Molecular Formula | C12H17BrO7 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | [(2S,3S,4R,5R)-4,5-diacetyloxy-6-bromo-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)C(Br)O[C@H]1C |
| InChI | InChI=1S/C12H17BrO7/c1-5-9(18-6(2)14)10(19-7(3)15)11(12(13)17-5)20-8(4)16/h5,9-12H,1-4H3/t5-,9-,10+,11+,12?/m0/s1 |
| InChIKey | XUZQAPSYNYIKSR-DXTUTJKPSA-N |
| XLogP | 0.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|