C12H17BrO8 — CID 69342653
[(2R,3S,4S,5R)-4,5-diacetyloxy-6-bromooxy-2-methyloxan-3-yl] acetate (PubChem CID 69342653) has the molecular formula C12H17BrO8 and a molecular weight of 369.16 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-4,5-diacetyloxy-6-bromooxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-4,5-diacetyloxy-6-bromooxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 69342653 |
| Molecular Formula | C12H17BrO8 |
| Molecular Weight | 369.16 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | [(2R,3S,4S,5R)-4,5-diacetyloxy-6-bromooxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)C(OBr)O[C@@H]1C |
| InChI | InChI=1S/C12H17BrO8/c1-5-9(18-6(2)14)10(19-7(3)15)11(20-8(4)16)12(17-5)21-13/h5,9-12H,1-4H3/t5-,9+,10+,11-,12?/m1/s1 |
| InChIKey | SPSCZONZJPJPIR-JPBJFVTKSA-N |
| XLogP | 0.85 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|