C14H20O9 — CID 70923261
[(2S,3S,5R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate (PubChem CID 70923261) has the molecular formula C14H20O9 and a molecular weight of 332.31 g/mol. Its IUPAC name is [(2S,3S,5R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,5R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 70923261 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | [(2S,3S,5R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@@H](C)[C@H](OC(C)=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H20O9/c1-6-11(20-7(2)15)12(21-8(3)16)13(22-9(4)17)14(19-6)23-10(5)18/h6,11-14H,1-5H3/t6-,11-,12?,13+,14?/m0/s1 |
| InChIKey | QZQMGQQOGJIDKJ-SXHOYDSESA-N |
| XLogP | 0.09 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|